![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | 01 Can't Get You Out Of My Head.mp3 | 2013-02-10 07:04 | 5.0M | |
| 01 Rapture.mp3 | 2013-02-10 07:04 | 4.3M | |
| 02 Starlight.mp3 | 2013-02-10 07:04 | 5.0M | |
| 02 Uptown Girl.mp3 | 2013-02-10 07:04 | 4.1M | |
| 03 Hey Baby!.mp3 | 2013-02-10 07:04 | 4.7M | |
| 03 Little L.mp3 | 2013-02-10 07:04 | 5.1M | |
| 04 Bootylicious.mp3 | 2013-02-10 07:04 | 4.6M | |
| 04 Mambo No.5.mp3 | 2013-02-10 07:04 | 4.3M | |
| 05 Chain Reaction.mp3 | 2013-02-10 07:04 | 5.1M | |
| 05 Purple Hills.mp3 | 2013-02-10 07:04 | 5.6M | |
| 06 Let's Dance.mp3 | 2013-02-10 07:04 | 4.7M | |
| 06 Let Me Blow Ya Mind.mp3 | 2013-02-10 07:04 | 4.9M | |
| 07 I'm A Slave 4 U.mp3 | 2013-02-10 07:04 | 4.5M | |
| 07 Take Me Home.mp3 | 2013-02-10 07:04 | 4.3M | |
| 08 One Night Stand.mp3 | 2013-02-10 07:04 | 4.5M | |
| 08 Perfect Gentleman.mp3 | 2013-02-10 07:04 | 4.4M | |
| 09 Family Affair.mp3 | 2013-02-10 07:04 | 4.5M | |
| 09 What Would You Do_.mp3 | 2013-02-10 07:04 | 3.9M | |
| 10 Baby Come On Over.mp3 | 2013-02-10 07:04 | 4.1M | |
| 10 If You Come Back.mp3 | 2013-02-10 07:04 | 4.5M | |
| 11 Thinking It Over.mp3 | 2013-02-10 07:04 | 5.2M | |
| 11 Turn Off The Light.mp3 | 2013-02-10 07:04 | 5.9M | |
| 12 Heaven Is A Halfpipe.mp3 | 2013-02-10 07:04 | 5.2M | |
| 12 Not Such An Innocent Girl.mp3 | 2013-02-10 07:04 | 4.4M | |
| 13 Bohemian Like You.mp3 | 2013-02-10 07:04 | 4.7M | |
| 13 Stuck In The Middle With You.mp3 | 2013-02-10 07:04 | 4.9M | |
| 14 Scream If You Wanna Go Faster.mp3 | 2013-02-10 07:04 | 4.5M | |
| 14 Smooth Criminal.mp3 | 2013-02-10 07:04 | 4.6M | |
| 15 Fat Lip.mp3 | 2013-02-10 07:04 | 4.1M | |
| 15 Things That Go Bump In The Night.mp3 | 2013-02-10 07:04 | 4.5M | |
| 16 A Little Respect.mp3 | 2013-02-10 07:04 | 4.6M | |
| 16 Set You Free.mp3 | 2013-02-10 07:04 | 5.3M | |
| 17 Flawless.mp3 | 2013-02-10 07:04 | 4.2M | |
| 17 Sing.mp3 | 2013-02-10 07:04 | 4.9M | |
| 18 Ain't It Funny.mp3 | 2013-02-10 07:04 | 5.2M | |
| 18 Digital Love.mp3 | 2013-02-10 07:04 | 5.1M | |
| 19 Superstylin'.mp3 | 2013-02-10 07:04 | 4.9M | |
| 19 Take My Breath Away.mp3 | 2013-02-10 07:04 | 4.8M | |
| 20 2 People.mp3 | 2013-02-10 07:04 | 3.9M | |
| 20 Don't Need The Sun To Shine (To Make Me Smile).mp3 | 2013-02-10 07:04 | 4.5M | |
| 21 (I Wish I Knew How It Would Feel To Be ) Free_One.mp3 | 2013-02-10 07:04 | 5.0M | |
| 21 21 Seconds.mp3 | 2013-02-10 07:04 | 3.7M | |
| 22 Because I Got High.mp3 | 2013-02-10 07:04 | 4.4M | |
| 22 What If.mp3 | 2013-02-10 07:04 | 5.3M | |
|
|---|